About 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine
2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine (PubChem CID 10265138) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine |
| PubChem CID | 10265138 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine |
| SMILES | CC1=CC(=O)c2cc(/C(C)=N/N=C(N)N)ccc2C1=O |
| InChI | InChI=1S/C14H14N4O2/c1-7-5-12(19)11-6-9(3-4-10(11)13(7)20)8(2)17-18-14(15)16/h3-6H,1-2H3,(H4,15,16,18)/b17-8+ |
| InChIKey | AJLGCFJNCBIPOH-CAOOACKPSA-N |
| XLogP | 1.01 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine?
The IUPAC name of 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine (CID 10265138) is 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine.
What is the SMILES notation for 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine?
The canonical SMILES for 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine is CC1=CC(=O)c2cc(/C(C)=N/N=C(N)N)ccc2C1=O.
What is the InChIKey of 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine?
The InChIKey is AJLGCFJNCBIPOH-CAOOACKPSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-7-5-12(19)11-6-9(3-4-10(11)13(7)20)8(2)17-18-14(15)16/h3-6H,1-2H3,(H4,15,16,18)/b17-8+.
What are the key properties of 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine?
2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine has a molecular weight of 270.29 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1-(6-methyl-5,8-dioxonaphthalen-2-yl)ethylideneamino]guanidine is sourced from PubChem (CID 10265138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).