C14H22O5 — CID 10265144
methyl (E)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate (PubChem CID 10265144) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is methyl (E)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10265144 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | methyl (E)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@]1(C)C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C14H22O5/c1-9-14(5,8-7-10(15)17-6)11(16)19-12(18-9)13(2,3)4/h7-9,12H,1-6H3/b8-7+/t9-,12-,14-/m1/s1 |
| InChIKey | OTGKKGNJEHHGIC-RBMWGPBUSA-N |
| XLogP | 2.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|