C14H22O5 — CID 10265146
(E)-4-methyl-1-[(2S,3R,4S)-2,3,4-trimethoxy-3,4-dihydro-2H-pyran-6-yl]pent-2-en-1-one (PubChem CID 10265146) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (E)-4-methyl-1-[(2S,3R,4S)-2,3,4-trimethoxy-3,4-dihydro-2H-pyran-6-yl]pent-2-en-1-one.
| Compound Name | (E)-4-methyl-1-[(2S,3R,4S)-2,3,4-trimethoxy-3,4-dihydro-2H-pyran-6-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 10265146 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (E)-4-methyl-1-[(2S,3R,4S)-2,3,4-trimethoxy-3,4-dihydro-2H-pyran-6-yl]pent-2-en-1-one |
| SMILES | CO[C@H]1OC(C(=O)/C=C/C(C)C)=C[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C14H22O5/c1-9(2)6-7-10(15)11-8-12(16-3)13(17-4)14(18-5)19-11/h6-9,12-14H,1-5H3/b7-6+/t12-,13+,14-/m0/s1 |
| InChIKey | VNQGROWPBFMVTD-IWPQLONXSA-N |
| XLogP | 1.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|