C10H19NO — CID 102651545
1-(2,3-dihydrofuran-5-yl)-N,2-dimethylbutan-1-amine (PubChem CID 102651545) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 102651545 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)C(NC)C1=CCCO1 |
| InChI | InChI=1S/C10H19NO/c1-4-8(2)10(11-3)9-6-5-7-12-9/h6,8,10-11H,4-5,7H2,1-3H3 |
| InChIKey | JWAGJIXRODYPMF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |