About 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate
3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate (PubChem CID 10265186) has the molecular formula C10H13N3O6
and a molecular weight of 271.23 g/mol. Its IUPAC name is 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate.
Molecular Properties
| Compound Name | 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate |
| PubChem CID | 10265186 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate |
| SMILES | Cc1c([N+](=O)[O-])c(=O)n(C)c(=O)n1CCCOC=O |
| InChI | InChI=1S/C10H13N3O6/c1-7-8(13(17)18)9(15)11(2)10(16)12(7)4-3-5-19-6-14/h6H,3-5H2,1-2H3 |
| InChIKey | UEWOEIKXEVETJF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 113.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate?
The IUPAC name of 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate (CID 10265186) is 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate.
What is the SMILES notation for 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate?
The canonical SMILES for 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate is Cc1c([N+](=O)[O-])c(=O)n(C)c(=O)n1CCCOC=O.
What is the InChIKey of 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate?
The InChIKey is UEWOEIKXEVETJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O6/c1-7-8(13(17)18)9(15)11(2)10(16)12(7)4-3-5-19-6-14/h6H,3-5H2,1-2H3.
What are the key properties of 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate?
3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate has a molecular weight of 271.23 g/mol, XLogP of -0.67, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dimethyl-5-nitro-2,4-dioxopyrimidin-1-yl)propyl formate is sourced from PubChem (CID 10265186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).