About (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine
(Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine (PubChem CID 102652357) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine |
| PubChem CID | 102652357 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine |
| SMILES | C/C(=C/CCNC(C)C)C1=CCCO1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)13-8-4-6-11(3)12-7-5-9-14-12/h6-7,10,13H,4-5,8-9H2,1-3H3/b11-6- |
| InChIKey | HPDOEYSMFQMILZ-WDZFZDKYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine?
The IUPAC name of (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine (CID 102652357) is (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine.
What is the SMILES notation for (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine?
The canonical SMILES for (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine is C/C(=C/CCNC(C)C)C1=CCCO1.
What is the InChIKey of (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine?
The InChIKey is HPDOEYSMFQMILZ-WDZFZDKYSA-N. The full InChI is InChI=1S/C12H21NO/c1-10(2)13-8-4-6-11(3)12-7-5-9-14-12/h6-7,10,13H,4-5,8-9H2,1-3H3/b11-6-.
What are the key properties of (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine?
(Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine has a molecular weight of 195.31 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(2,3-dihydrofuran-5-yl)-N-propan-2-ylpent-3-en-1-amine is sourced from PubChem (CID 102652357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).