About 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine
3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine (PubChem CID 102652373) has the molecular formula C10H16FNO
and a molecular weight of 185.24 g/mol. Its IUPAC name is 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine.
Molecular Properties
| Compound Name | 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine |
| PubChem CID | 102652373 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine |
| SMILES | FC(C1=CCCO1)C1CCCNC1 |
| InChI | InChI=1S/C10H16FNO/c11-10(9-4-2-6-13-9)8-3-1-5-12-7-8/h4,8,10,12H,1-3,5-7H2 |
| InChIKey | QXTAQFSRNMERKS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine?
The IUPAC name of 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine (CID 102652373) is 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine.
What is the SMILES notation for 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine?
The canonical SMILES for 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine is FC(C1=CCCO1)C1CCCNC1.
What is the InChIKey of 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine?
The InChIKey is QXTAQFSRNMERKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FNO/c11-10(9-4-2-6-13-9)8-3-1-5-12-7-8/h4,8,10,12H,1-3,5-7H2.
What are the key properties of 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine?
3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine has a molecular weight of 185.24 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine is sourced from PubChem (CID 102652373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).