About 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one
3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one (PubChem CID 102652402) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one |
| PubChem CID | 102652402 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one |
| SMILES | NCCC(=O)C1=CCCO1 |
| InChI | InChI=1S/C7H11NO2/c8-4-3-6(9)7-2-1-5-10-7/h2H,1,3-5,8H2 |
| InChIKey | WTRCHYQLACYUNL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one?
The IUPAC name of 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one (CID 102652402) is 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one.
What is the SMILES notation for 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one?
The canonical SMILES for 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one is NCCC(=O)C1=CCCO1.
What is the InChIKey of 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one?
The InChIKey is WTRCHYQLACYUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c8-4-3-6(9)7-2-1-5-10-7/h2H,1,3-5,8H2.
What are the key properties of 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one?
3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one has a molecular weight of 141.17 g/mol, XLogP of 0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,3-dihydrofuran-5-yl)propan-1-one is sourced from PubChem (CID 102652402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).