C11H17NO3 — CID 102652476
1-(2,3-dihydrofuran-5-yl)-2-piperidin-4-yloxyethanone (PubChem CID 102652476) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-2-piperidin-4-yloxyethanone.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-2-piperidin-4-yloxyethanone |
|---|---|
| PubChem CID | 102652476 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-2-piperidin-4-yloxyethanone |
| SMILES | O=C(COC1CCNCC1)C1=CCCO1 |
| InChI | InChI=1S/C11H17NO3/c13-10(11-2-1-7-14-11)8-15-9-3-5-12-6-4-9/h2,9,12H,1,3-8H2 |
| InChIKey | JBWRDXNWINLRAG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |