About 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one
1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one (PubChem CID 10265248) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one.
Molecular Properties
| Compound Name | 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one |
| PubChem CID | 10265248 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one |
| SMILES | CCc1nn(CC)c2c(=O)oc3c(C)c(O)ccc3c12 |
| InChI | InChI=1S/C15H16N2O3/c1-4-10-12-9-6-7-11(18)8(3)14(9)20-15(19)13(12)17(5-2)16-10/h6-7,18H,4-5H2,1-3H3 |
| InChIKey | OBOYHNKCCDDSRX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one?
The IUPAC name of 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one (CID 10265248) is 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one.
What is the SMILES notation for 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one?
The canonical SMILES for 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one is CCc1nn(CC)c2c(=O)oc3c(C)c(O)ccc3c12.
What is the InChIKey of 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one?
The InChIKey is OBOYHNKCCDDSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-4-10-12-9-6-7-11(18)8(3)14(9)20-15(19)13(12)17(5-2)16-10/h6-7,18H,4-5H2,1-3H3.
What are the key properties of 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one?
1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one has a molecular weight of 272.30 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-7-hydroxy-6-methylchromeno[4,3-d]pyrazol-4-one is sourced from PubChem (CID 10265248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).