About azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone
azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone (PubChem CID 102652521) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone.
Molecular Properties
| Compound Name | azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone |
| PubChem CID | 102652521 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone |
| SMILES | O=C(C1=CCCO1)C1CNC1 |
| InChI | InChI=1S/C8H11NO2/c10-8(6-4-9-5-6)7-2-1-3-11-7/h2,6,9H,1,3-5H2 |
| InChIKey | OQZSNCHNNJTXHH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone?
The IUPAC name of azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone (CID 102652521) is azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone.
What is the SMILES notation for azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone?
The canonical SMILES for azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone is O=C(C1=CCCO1)C1CNC1.
What is the InChIKey of azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone?
The InChIKey is OQZSNCHNNJTXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c10-8(6-4-9-5-6)7-2-1-3-11-7/h2,6,9H,1,3-5H2.
What are the key properties of azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone?
azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone has a molecular weight of 153.18 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-yl(2,3-dihydrofuran-5-yl)methanone is sourced from PubChem (CID 102652521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).