C18H35NO — CID 102653271
1-(2,3-dihydrofuran-5-yl)-N-ethyldodecan-1-amine (PubChem CID 102653271) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-N-ethyldodecan-1-amine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-N-ethyldodecan-1-amine |
|---|---|
| PubChem CID | 102653271 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-N-ethyldodecan-1-amine |
| SMILES | CCCCCCCCCCCC(NCC)C1=CCCO1 |
| InChI | InChI=1S/C18H35NO/c1-3-5-6-7-8-9-10-11-12-14-17(19-4-2)18-15-13-16-20-18/h15,17,19H,3-14,16H2,1-2H3 |
| InChIKey | GJUAOPSQXBVWRU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|