2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid

C11H8F2O4S — CID 10265341

IUPAC2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid
SMILESO=C1CCC(Sc2ccc(F)cc2F)(C(=O)O)O1
InChIInChI=1S/C11H8F2O4S/c12-6-1-2-8(7(13)5-6)18-11(10(15)16)4-3-9(14)17-11/h1-2,5H,3-4H2,(H,15,16)
InChIKeySHSJTJIKELANFA-UHFFFAOYSA-N
MW274.24 g/mol
LogP2.17
Rot. Bonds3

About 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid

2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid (PubChem CID 10265341) has the molecular formula C11H8F2O4S and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid
PubChem CID10265341
Molecular FormulaC11H8F2O4S
Molecular Weight274.24 g/mol
Exact Mass274.01
IUPAC Name2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid
SMILESO=C1CCC(Sc2ccc(F)cc2F)(C(=O)O)O1
InChIInChI=1S/C11H8F2O4S/c12-6-1-2-8(7(13)5-6)18-11(10(15)16)4-3-9(14)17-11/h1-2,5H,3-4H2,(H,15,16)
InChIKeySHSJTJIKELANFA-UHFFFAOYSA-N
XLogP2.17
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.24
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid?
The IUPAC name of 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid (CID 10265341) is 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid.
What is the SMILES notation for 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid?
The canonical SMILES for 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid is O=C1CCC(Sc2ccc(F)cc2F)(C(=O)O)O1.
What is the InChIKey of 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid?
The InChIKey is SHSJTJIKELANFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2O4S/c12-6-1-2-8(7(13)5-6)18-11(10(15)16)4-3-9(14)17-11/h1-2,5H,3-4H2,(H,15,16).
What are the key properties of 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid?
2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid has a molecular weight of 274.24 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)sulfanyl-5-oxooxolane-2-carboxylic acid is sourced from PubChem (CID 10265341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).