About 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol
2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol (PubChem CID 102653846) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol.
Molecular Properties
| Compound Name | 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol |
| PubChem CID | 102653846 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol |
| SMILES | CC12CC3CC(C)(C1)CC(C(O)C1=CCCO1)(C3)C2 |
| InChI | InChI=1S/C17H26O2/c1-15-6-12-7-16(2,9-15)11-17(8-12,10-15)14(18)13-4-3-5-19-13/h4,12,14,18H,3,5-11H2,1-2H3 |
| InChIKey | HWJXTSJSONWCKL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol?
The IUPAC name of 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol (CID 102653846) is 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol.
What is the SMILES notation for 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol?
The canonical SMILES for 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol is CC12CC3CC(C)(C1)CC(C(O)C1=CCCO1)(C3)C2.
What is the InChIKey of 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol?
The InChIKey is HWJXTSJSONWCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-15-6-12-7-16(2,9-15)11-17(8-12,10-15)14(18)13-4-3-5-19-13/h4,12,14,18H,3,5-11H2,1-2H3.
What are the key properties of 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol?
2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol has a molecular weight of 262.39 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuran-5-yl-(3,5-dimethyl-1-adamantyl)methanol is sourced from PubChem (CID 102653846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).