About [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine
[2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine (PubChem CID 102654178) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine |
| PubChem CID | 102654178 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C1CCCO1 |
| InChI | InChI=1S/C9H16N2O2/c10-11-9(7-3-1-5-12-7)8-4-2-6-13-8/h3,8-9,11H,1-2,4-6,10H2 |
| InChIKey | AOQFBZHRWUKZOA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine?
The IUPAC name of [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine (CID 102654178) is [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine.
What is the SMILES notation for [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine?
The canonical SMILES for [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine is NNC(C1=CCCO1)C1CCCO1.
What is the InChIKey of [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine?
The InChIKey is AOQFBZHRWUKZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c10-11-9(7-3-1-5-12-7)8-4-2-6-13-8/h3,8-9,11H,1-2,4-6,10H2.
What are the key properties of [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine?
[2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine has a molecular weight of 184.24 g/mol, XLogP of 0.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dihydrofuran-5-yl(oxolan-2-yl)methyl]hydrazine is sourced from PubChem (CID 102654178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).