C6H10F2N2O — CID 102654311
[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 102654311) has the molecular formula C6H10F2N2O and a molecular weight of 164.16 g/mol. Its IUPAC name is [1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 102654311 |
| Molecular Formula | C6H10F2N2O |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | [1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C(F)F |
| InChI | InChI=1S/C6H10F2N2O/c7-6(8)5(10-9)4-2-1-3-11-4/h2,5-6,10H,1,3,9H2 |
| InChIKey | MMHYXOYKZNMDHI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|