About [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine
[2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine (PubChem CID 102654487) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine |
| PubChem CID | 102654487 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C1COCCO1 |
| InChI | InChI=1S/C9H16N2O3/c10-11-9(7-2-1-3-13-7)8-6-12-4-5-14-8/h2,8-9,11H,1,3-6,10H2 |
| InChIKey | YFXWDVZRFRVNMH-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine?
The IUPAC name of [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine (CID 102654487) is [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine.
What is the SMILES notation for [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine?
The canonical SMILES for [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine is NNC(C1=CCCO1)C1COCCO1.
What is the InChIKey of [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine?
The InChIKey is YFXWDVZRFRVNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c10-11-9(7-2-1-3-13-7)8-6-12-4-5-14-8/h2,8-9,11H,1,3-6,10H2.
What are the key properties of [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine?
[2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine has a molecular weight of 200.24 g/mol, XLogP of -0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methyl]hydrazine is sourced from PubChem (CID 102654487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).