C14H21N5O — CID 102655086
3-[(1S)-1,5-diaminopentyl]-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one (PubChem CID 102655086) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-[(1S)-1,5-diaminopentyl]-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(1S)-1,5-diaminopentyl]-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102655086 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-[(1S)-1,5-diaminopentyl]-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one |
| SMILES | Cc1ccc(-n2c([C@@H](N)CCCCN)n[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H21N5O/c1-10-5-7-11(8-6-10)19-13(17-18-14(19)20)12(16)4-2-3-9-15/h5-8,12H,2-4,9,15-16H2,1H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | TVFCLXQSSHZHSH-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|