C13H25N5O — CID 102655220
4-cyclohexyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one (PubChem CID 102655220) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-cyclohexyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-cyclohexyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102655220 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 4-cyclohexyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one |
| SMILES | NCCCCC(N)c1n[nH]c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/C13H25N5O/c14-9-5-4-8-11(15)12-16-17-13(19)18(12)10-6-2-1-3-7-10/h10-11H,1-9,14-15H2,(H,17,19) |
| InChIKey | NZLOLEMIIQHLOX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|