C16H22N4O — CID 102655259
3-(2-amino-2-phenylethyl)-4-cyclohexyl-1H-1,2,4-triazol-5-one (PubChem CID 102655259) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-(2-amino-2-phenylethyl)-4-cyclohexyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2-amino-2-phenylethyl)-4-cyclohexyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102655259 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3-(2-amino-2-phenylethyl)-4-cyclohexyl-1H-1,2,4-triazol-5-one |
| SMILES | NC(Cc1n[nH]c(=O)n1C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H22N4O/c17-14(12-7-3-1-4-8-12)11-15-18-19-16(21)20(15)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-11,17H2,(H,19,21) |
| InChIKey | GRCHJJHBCLDUCX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |