About methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate
methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate (PubChem CID 10265549) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate |
| PubChem CID | 10265549 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1C1(O)C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C15H18O5/c1-9-7-10(16)8-14(2,3)15(9,18)12-11(5-6-20-12)13(17)19-4/h5-7,18H,8H2,1-4H3 |
| InChIKey | YFUQKPRFRYPKBJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate?
The IUPAC name of methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate (CID 10265549) is methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate.
What is the SMILES notation for methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate?
The canonical SMILES for methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate is COC(=O)c1ccoc1C1(O)C(C)=CC(=O)CC1(C)C.
What is the InChIKey of methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate?
The InChIKey is YFUQKPRFRYPKBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O5/c1-9-7-10(16)8-14(2,3)15(9,18)12-11(5-6-20-12)13(17)19-4/h5-7,18H,8H2,1-4H3.
What are the key properties of methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate?
methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate has a molecular weight of 278.30 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)furan-3-carboxylate is sourced from PubChem (CID 10265549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).