C7H10N4O4S2 — CID 10265554
(8-amino-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-7-yl)sulfamic acid (PubChem CID 10265554) has the molecular formula C7H10N4O4S2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (8-amino-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-7-yl)sulfamic acid.
| Compound Name | (8-amino-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-7-yl)sulfamic acid |
|---|---|
| PubChem CID | 10265554 |
| Molecular Formula | C7H10N4O4S2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | (8-amino-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-7-yl)sulfamic acid |
| SMILES | Nc1nc2n(c(=O)c1NS(=O)(=O)O)CCCS2 |
| InChI | InChI=1S/C7H10N4O4S2/c8-5-4(10-17(13,14)15)6(12)11-2-1-3-16-7(11)9-5/h10H,1-3,8H2,(H,13,14,15) |
| InChIKey | LYEMNKWJRALJKO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|