C12H18N6O2 — CID 10265557
N-hydroxy-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]pentanamide (PubChem CID 10265557) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is N-hydroxy-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]pentanamide.
| Compound Name | N-hydroxy-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]pentanamide |
|---|---|
| PubChem CID | 10265557 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-hydroxy-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]pentanamide |
| SMILES | CNc1nc(C)nc2c(CCCCC(=O)NO)cnn12 |
| InChI | InChI=1S/C12H18N6O2/c1-8-15-11-9(5-3-4-6-10(19)17-20)7-14-18(11)12(13-2)16-8/h7,20H,3-6H2,1-2H3,(H,17,19)(H,13,15,16) |
| InChIKey | BFHKRNAGSQHCSE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|