C11H22N2O2 — CID 102657056
2-[2-(3-methylazetidin-3-yl)oxyethyl-prop-2-enylamino]ethanol (PubChem CID 102657056) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-[2-(3-methylazetidin-3-yl)oxyethyl-prop-2-enylamino]ethanol.
| Compound Name | 2-[2-(3-methylazetidin-3-yl)oxyethyl-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 102657056 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-[2-(3-methylazetidin-3-yl)oxyethyl-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)CCOC1(C)CNC1 |
| InChI | InChI=1S/C11H22N2O2/c1-3-4-13(5-7-14)6-8-15-11(2)9-12-10-11/h3,12,14H,1,4-10H2,2H3 |
| InChIKey | KMKGEOXHXFRMEH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|