C13H23N5O2 — CID 10265737
9-(5-hydroxypentyl)-2,2-dimethyl-3,4-dihydro-1H-purine-6-carboxamide (PubChem CID 10265737) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 9-(5-hydroxypentyl)-2,2-dimethyl-3,4-dihydro-1H-purine-6-carboxamide.
| Compound Name | 9-(5-hydroxypentyl)-2,2-dimethyl-3,4-dihydro-1H-purine-6-carboxamide |
|---|---|
| PubChem CID | 10265737 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 9-(5-hydroxypentyl)-2,2-dimethyl-3,4-dihydro-1H-purine-6-carboxamide |
| SMILES | CC1(C)NC(C(N)=O)=C2N=CN(CCCCCO)C2N1 |
| InChI | InChI=1S/C13H23N5O2/c1-13(2)16-9(11(14)20)10-12(17-13)18(8-15-10)6-4-3-5-7-19/h8,12,16-17,19H,3-7H2,1-2H3,(H2,14,20) |
| InChIKey | PBOHRKKWDKGUKG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|