C13H13F3N4 — CID 10265764
6-ethyl-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 10265764) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 6-ethyl-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10265764 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-ethyl-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N4/c1-2-9-10(11(17)20-12(18)19-9)7-3-5-8(6-4-7)13(14,15)16/h3-6H,2H2,1H3,(H4,17,18,19,20) |
| InChIKey | VLKKZYOUJMHNRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |