C18H18O3 — CID 10265793
(1S,2R,3S,4S,5R,9S,10R,15R)-7-oxaheptacyclo[9.6.2.02,10.03,15.04,12.05,9.014,18]nonadec-16-ene-6,8-dione (PubChem CID 10265793) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,2R,3S,4S,5R,9S,10R,15R)-7-oxaheptacyclo[9.6.2.02,10.03,15.04,12.05,9.014,18]nonadec-16-ene-6,8-dione.
| Compound Name | (1S,2R,3S,4S,5R,9S,10R,15R)-7-oxaheptacyclo[9.6.2.02,10.03,15.04,12.05,9.014,18]nonadec-16-ene-6,8-dione |
|---|---|
| PubChem CID | 10265793 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (1S,2R,3S,4S,5R,9S,10R,15R)-7-oxaheptacyclo[9.6.2.02,10.03,15.04,12.05,9.014,18]nonadec-16-ene-6,8-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@@H]1C3CC4C5CC3[C@H]2[C@@H]2[C@H]1[C@H]4C=C[C@H]52 |
| InChI | InChI=1S/C18H18O3/c19-17-15-13-9-3-7-5-1-2-6-8(7)4-10(9)14(12(6)11(5)13)16(15)18(20)21-17/h1-2,5-16H,3-4H2/t5-,6+,7?,8?,9?,10?,11+,12-,13+,14-,15-,16+ |
| InChIKey | WBQJBWNAQQNMHD-GMCKXIBRSA-N |
| XLogP | 1.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|