C13H19N3O4 — CID 102658023
2-[3-methyl-1-(6-propan-2-yloxypyrimidin-4-yl)azetidin-3-yl]oxyacetic acid (PubChem CID 102658023) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[3-methyl-1-(6-propan-2-yloxypyrimidin-4-yl)azetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[3-methyl-1-(6-propan-2-yloxypyrimidin-4-yl)azetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102658023 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[3-methyl-1-(6-propan-2-yloxypyrimidin-4-yl)azetidin-3-yl]oxyacetic acid |
| SMILES | CC(C)Oc1cc(N2CC(C)(OCC(=O)O)C2)ncn1 |
| InChI | InChI=1S/C13H19N3O4/c1-9(2)20-11-4-10(14-8-15-11)16-6-13(3,7-16)19-5-12(17)18/h4,8-9H,5-7H2,1-3H3,(H,17,18) |
| InChIKey | SUCCXICPIUONEG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |