C12H12ClFN2O5 — CID 102658065
2-[1-(4-chloro-5-fluoro-2-nitrophenyl)-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 102658065) has the molecular formula C12H12ClFN2O5 and a molecular weight of 318.69 g/mol. Its IUPAC name is 2-[1-(4-chloro-5-fluoro-2-nitrophenyl)-3-methylazetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-(4-chloro-5-fluoro-2-nitrophenyl)-3-methylazetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102658065 |
| Molecular Formula | C12H12ClFN2O5 |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[1-(4-chloro-5-fluoro-2-nitrophenyl)-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | CC1(OCC(=O)O)CN(c2cc(F)c(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H12ClFN2O5/c1-12(21-4-11(17)18)5-15(6-12)9-3-8(14)7(13)2-10(9)16(19)20/h2-3H,4-6H2,1H3,(H,17,18) |
| InChIKey | NAQNVZDBNXQXOH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|