About 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid
2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 102658233) has the molecular formula C13H23N3O4
and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid |
| PubChem CID | 102658233 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | CC1(OCC(=O)O)CN(C(=O)CN2CCCNCC2)C1 |
| InChI | InChI=1S/C13H23N3O4/c1-13(20-8-12(18)19)9-16(10-13)11(17)7-15-5-2-3-14-4-6-15/h14H,2-10H2,1H3,(H,18,19) |
| InChIKey | WAQGUOIXJIXLIV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid?
The IUPAC name of 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid (CID 102658233) is 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid.
What is the SMILES notation for 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid?
The canonical SMILES for 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid is CC1(OCC(=O)O)CN(C(=O)CN2CCCNCC2)C1.
What is the InChIKey of 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid?
The InChIKey is WAQGUOIXJIXLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O4/c1-13(20-8-12(18)19)9-16(10-13)11(17)7-15-5-2-3-14-4-6-15/h14H,2-10H2,1H3,(H,18,19).
What are the key properties of 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid?
2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid has a molecular weight of 285.34 g/mol, XLogP of -1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(1,4-diazepan-1-yl)acetyl]-3-methylazetidin-3-yl]oxyacetic acid is sourced from PubChem (CID 102658233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).