C12H19N3O5 — CID 102658909
2-[3-methyl-1-(2-methyl-3-oxopiperazine-1-carbonyl)azetidin-3-yl]oxyacetic acid (PubChem CID 102658909) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[3-methyl-1-(2-methyl-3-oxopiperazine-1-carbonyl)azetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[3-methyl-1-(2-methyl-3-oxopiperazine-1-carbonyl)azetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102658909 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[3-methyl-1-(2-methyl-3-oxopiperazine-1-carbonyl)azetidin-3-yl]oxyacetic acid |
| SMILES | CC1C(=O)NCCN1C(=O)N1CC(C)(OCC(=O)O)C1 |
| InChI | InChI=1S/C12H19N3O5/c1-8-10(18)13-3-4-15(8)11(19)14-6-12(2,7-14)20-5-9(16)17/h8H,3-7H2,1-2H3,(H,13,18)(H,16,17) |
| InChIKey | UYMSFGYBVOFCFQ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |