About 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol
1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660564) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol.
Molecular Properties
| Compound Name | 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol |
| PubChem CID | 102660564 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CCC(C)Cc1nc(C(C)O)no1 |
| InChI | InChI=1S/C9H16N2O2/c1-4-6(2)5-8-10-9(7(3)12)11-13-8/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | RHNGBQTZXVPWQY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol?
The IUPAC name of 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol (CID 102660564) is 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol.
What is the SMILES notation for 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol?
The canonical SMILES for 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol is CCC(C)Cc1nc(C(C)O)no1.
What is the InChIKey of 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol?
The InChIKey is RHNGBQTZXVPWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-4-6(2)5-8-10-9(7(3)12)11-13-8/h6-7,12H,4-5H2,1-3H3.
What are the key properties of 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol?
1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol has a molecular weight of 184.24 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-methylbutyl)-1,2,4-oxadiazol-3-yl]ethanol is sourced from PubChem (CID 102660564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).