C17H25N3O — CID 102661728
N-cyclopropyl-N-methyl-2-[5-[1-(methylamino)ethyl]-2,3-dihydroindol-1-yl]acetamide (PubChem CID 102661728) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-2-[5-[1-(methylamino)ethyl]-2,3-dihydroindol-1-yl]acetamide.
| Compound Name | N-cyclopropyl-N-methyl-2-[5-[1-(methylamino)ethyl]-2,3-dihydroindol-1-yl]acetamide |
|---|---|
| PubChem CID | 102661728 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-cyclopropyl-N-methyl-2-[5-[1-(methylamino)ethyl]-2,3-dihydroindol-1-yl]acetamide |
| SMILES | CNC(C)c1ccc2c(c1)CCN2CC(=O)N(C)C1CC1 |
| InChI | InChI=1S/C17H25N3O/c1-12(18-2)13-4-7-16-14(10-13)8-9-20(16)11-17(21)19(3)15-5-6-15/h4,7,10,12,15,18H,5-6,8-9,11H2,1-3H3 |
| InChIKey | KLWUUJVYRMNAMZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|