C18H28N2O — CID 102662076
N-ethyl-1-[1-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine (PubChem CID 102662076) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-ethyl-1-[1-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine.
| Compound Name | N-ethyl-1-[1-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine |
|---|---|
| PubChem CID | 102662076 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-ethyl-1-[1-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinolin-6-yl]ethanamine |
| SMILES | CCNC(C)c1ccc2c(c1)CCCN2CC1CCCO1 |
| InChI | InChI=1S/C18H28N2O/c1-3-19-14(2)15-8-9-18-16(12-15)6-4-10-20(18)13-17-7-5-11-21-17/h8-9,12,14,17,19H,3-7,10-11,13H2,1-2H3 |
| InChIKey | OXCOQPDZSOXVLG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|