C12H14N6OS — CID 10266231
11-(cyclohexylmethyl)-10-thia-1,4,5,6,8,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6,8,11-tetraen-2-one (PubChem CID 10266231) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 11-(cyclohexylmethyl)-10-thia-1,4,5,6,8,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6,8,11-tetraen-2-one.
| Compound Name | 11-(cyclohexylmethyl)-10-thia-1,4,5,6,8,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 10266231 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 11-(cyclohexylmethyl)-10-thia-1,4,5,6,8,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6,8,11-tetraen-2-one |
| SMILES | O=c1c2n[nH]nc2nc2sc(CC3CCCCC3)nn12 |
| InChI | InChI=1S/C12H14N6OS/c19-11-9-10(15-17-14-9)13-12-18(11)16-8(20-12)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,14,15,17) |
| InChIKey | MLPPEIKUMYQIPH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |