About (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol
(3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol (PubChem CID 10266343) has the molecular formula C14H28O6
and a molecular weight of 292.37 g/mol. Its IUPAC name is (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol.
Molecular Properties
| Compound Name | (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol |
| PubChem CID | 10266343 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol |
| SMILES | C=C(C)C(O)[C@@H](OCOC)[C@@H](CCO)CCOCOC |
| InChI | InChI=1S/C14H28O6/c1-11(2)13(16)14(20-10-18-4)12(5-7-15)6-8-19-9-17-3/h12-16H,1,5-10H2,2-4H3/t12-,13?,14-/m0/s1 |
| InChIKey | COUXOOUABUEOCK-HPNRGHHYSA-N |
| XLogP | 0.92 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol?
The IUPAC name of (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol (CID 10266343) is (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol.
What is the SMILES notation for (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol?
The canonical SMILES for (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol is C=C(C)C(O)[C@@H](OCOC)[C@@H](CCO)CCOCOC.
What is the InChIKey of (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol?
The InChIKey is COUXOOUABUEOCK-HPNRGHHYSA-N. The full InChI is InChI=1S/C14H28O6/c1-11(2)13(16)14(20-10-18-4)12(5-7-15)6-8-19-9-17-3/h12-16H,1,5-10H2,2-4H3/t12-,13?,14-/m0/s1.
What are the key properties of (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol?
(3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol has a molecular weight of 292.37 g/mol, XLogP of 0.92, 13 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-6-methylhept-6-ene-1,5-diol is sourced from PubChem (CID 10266343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).