C16H11ClN4 — CID 10266483
4-(4-chlorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-9-amine (PubChem CID 10266483) has the molecular formula C16H11ClN4 and a molecular weight of 294.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-9-amine.
| Compound Name | 4-(4-chlorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-9-amine |
|---|---|
| PubChem CID | 10266483 |
| Molecular Formula | C16H11ClN4 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-(4-chlorophenyl)-2,5,7-triazatricyclo[6.5.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-9-amine |
| SMILES | Nc1ccccc2c1nc1nc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C16H11ClN4/c17-11-7-5-10(6-8-11)13-9-21-14-4-2-1-3-12(18)15(14)20-16(21)19-13/h1-9H,18H2 |
| InChIKey | RBRIGIJMCCGCEJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |