C12H15ClN2O — CID 102665091
4-[(but-3-en-2-ylamino)methyl]-3-chlorobenzamide (PubChem CID 102665091) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 4-[(but-3-en-2-ylamino)methyl]-3-chlorobenzamide.
| Compound Name | 4-[(but-3-en-2-ylamino)methyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 102665091 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-[(but-3-en-2-ylamino)methyl]-3-chlorobenzamide |
| SMILES | C=CC(C)NCc1ccc(C(N)=O)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O/c1-3-8(2)15-7-10-5-4-9(12(14)16)6-11(10)13/h3-6,8,15H,1,7H2,2H3,(H2,14,16) |
| InChIKey | HUUDVPHJYUHYJW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|