C11H13ClN2O — CID 102665322
3-chloro-4-[[2-hydroxyethyl(methyl)amino]methyl]benzonitrile (PubChem CID 102665322) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 3-chloro-4-[[2-hydroxyethyl(methyl)amino]methyl]benzonitrile.
| Compound Name | 3-chloro-4-[[2-hydroxyethyl(methyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 102665322 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-chloro-4-[[2-hydroxyethyl(methyl)amino]methyl]benzonitrile |
| SMILES | CN(CCO)Cc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C11H13ClN2O/c1-14(4-5-15)8-10-3-2-9(7-13)6-11(10)12/h2-3,6,15H,4-5,8H2,1H3 |
| InChIKey | IZFNBNMFUVIBMP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |