C14H14ClN3O2 — CID 102665628
3-chloro-4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]benzonitrile (PubChem CID 102665628) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 3-chloro-4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 102665628 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-chloro-4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]benzonitrile |
| SMILES | CCCC1NC(=O)N(Cc2ccc(C#N)cc2Cl)C1=O |
| InChI | InChI=1S/C14H14ClN3O2/c1-2-3-12-13(19)18(14(20)17-12)8-10-5-4-9(7-16)6-11(10)15/h4-6,12H,2-3,8H2,1H3,(H,17,20) |
| InChIKey | PINGHMGIRDVFDA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|