C16H14ClNO — CID 102665776
3-chloro-4-[(2,3-dimethylphenoxy)methyl]benzonitrile (PubChem CID 102665776) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-chloro-4-[(2,3-dimethylphenoxy)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(2,3-dimethylphenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 102665776 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-chloro-4-[(2,3-dimethylphenoxy)methyl]benzonitrile |
| SMILES | Cc1cccc(OCc2ccc(C#N)cc2Cl)c1C |
| InChI | InChI=1S/C16H14ClNO/c1-11-4-3-5-16(12(11)2)19-10-14-7-6-13(9-18)8-15(14)17/h3-8H,10H2,1-2H3 |
| InChIKey | IAGTWFSEENNMFC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |