C14H18ClNO — CID 102665948
3-chloro-4-(3,3-dimethylbutoxymethyl)benzonitrile (PubChem CID 102665948) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 3-chloro-4-(3,3-dimethylbutoxymethyl)benzonitrile.
| Compound Name | 3-chloro-4-(3,3-dimethylbutoxymethyl)benzonitrile |
|---|---|
| PubChem CID | 102665948 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-chloro-4-(3,3-dimethylbutoxymethyl)benzonitrile |
| SMILES | CC(C)(C)CCOCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C14H18ClNO/c1-14(2,3)6-7-17-10-12-5-4-11(9-16)8-13(12)15/h4-5,8H,6-7,10H2,1-3H3 |
| InChIKey | BGXTZDYWWUIANQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|