About (2-anilino-2-oxoethyl) morpholine-4-carbodithioate
(2-anilino-2-oxoethyl) morpholine-4-carbodithioate (PubChem CID 10266595) has the molecular formula C13H16N2O2S2
and a molecular weight of 296.42 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) morpholine-4-carbodithioate.
Molecular Properties
| Compound Name | (2-anilino-2-oxoethyl) morpholine-4-carbodithioate |
| PubChem CID | 10266595 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (2-anilino-2-oxoethyl) morpholine-4-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCOCC1)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2S2/c16-12(14-11-4-2-1-3-5-11)10-19-13(18)15-6-8-17-9-7-15/h1-5H,6-10H2,(H,14,16) |
| InChIKey | USMMMSGLPVJYOE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-anilino-2-oxoethyl) morpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-2-oxoethyl) morpholine-4-carbodithioate?
The IUPAC name of (2-anilino-2-oxoethyl) morpholine-4-carbodithioate (CID 10266595) is (2-anilino-2-oxoethyl) morpholine-4-carbodithioate.
What is the SMILES notation for (2-anilino-2-oxoethyl) morpholine-4-carbodithioate?
The canonical SMILES for (2-anilino-2-oxoethyl) morpholine-4-carbodithioate is O=C(CSC(=S)N1CCOCC1)Nc1ccccc1.
What is the InChIKey of (2-anilino-2-oxoethyl) morpholine-4-carbodithioate?
The InChIKey is USMMMSGLPVJYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S2/c16-12(14-11-4-2-1-3-5-11)10-19-13(18)15-6-8-17-9-7-15/h1-5H,6-10H2,(H,14,16).
What are the key properties of (2-anilino-2-oxoethyl) morpholine-4-carbodithioate?
(2-anilino-2-oxoethyl) morpholine-4-carbodithioate has a molecular weight of 296.42 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-2-oxoethyl) morpholine-4-carbodithioate is sourced from PubChem (CID 10266595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).