About 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene
1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene (PubChem CID 10266736) has the molecular formula C12H15N3O6
and a molecular weight of 299.26 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene.
Molecular Properties
| Compound Name | 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene |
| PubChem CID | 10266736 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene |
| SMILES | Cc1c([N+](=O)[O-])c([14CH3])c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O6/c1-6-9(13(16)17)7(2)11(15(20)21)8(12(3,4)5)10(6)14(18)19/h1-5H3/i1+2 |
| InChIKey | XMWRWTSZNLOZFN-NJFSPNSNSA-N |
| XLogP | 3.33 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene?
The IUPAC name of 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene (CID 10266736) is 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene.
What is the SMILES notation for 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene?
The canonical SMILES for 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene is Cc1c([N+](=O)[O-])c([14CH3])c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-].
What is the InChIKey of 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene?
The InChIKey is XMWRWTSZNLOZFN-NJFSPNSNSA-N. The full InChI is InChI=1S/C12H15N3O6/c1-6-9(13(16)17)7(2)11(15(20)21)8(12(3,4)5)10(6)14(18)19/h1-5H3/i1+2.
What are the key properties of 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene?
1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene has a molecular weight of 299.26 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-methyl-5-(114C)methyl-2,4,6-trinitrobenzene is sourced from PubChem (CID 10266736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).