C15H23ClN4O — CID 102667525
3-chloro-N'-hydroxy-4-[(3,4,5-trimethylpiperazin-1-yl)methyl]benzenecarboximidamide (PubChem CID 102667525) has the molecular formula C15H23ClN4O and a molecular weight of 310.83 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-[(3,4,5-trimethylpiperazin-1-yl)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-[(3,4,5-trimethylpiperazin-1-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102667525 |
| Molecular Formula | C15H23ClN4O |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-[(3,4,5-trimethylpiperazin-1-yl)methyl]benzenecarboximidamide |
| SMILES | CC1CN(Cc2ccc(/C(N)=N/O)cc2Cl)CC(C)N1C |
| InChI | InChI=1S/C15H23ClN4O/c1-10-7-20(8-11(2)19(10)3)9-13-5-4-12(6-14(13)16)15(17)18-21/h4-6,10-11,21H,7-9H2,1-3H3,(H2,17,18) |
| InChIKey | REYMSFGISPCOHI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|