C14H20ClN3 — CID 102667964
3-chloro-4-[(3,4-dimethylpyrrolidin-1-yl)methyl]benzenecarboximidamide (PubChem CID 102667964) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 3-chloro-4-[(3,4-dimethylpyrrolidin-1-yl)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[(3,4-dimethylpyrrolidin-1-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102667964 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-chloro-4-[(3,4-dimethylpyrrolidin-1-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CC(C)C(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClN3/c1-9-6-18(7-10(9)2)8-12-4-3-11(14(16)17)5-13(12)15/h3-5,9-10H,6-8H2,1-2H3,(H3,16,17) |
| InChIKey | RCLYYIVXZNKNLP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|