About phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol
phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol (PubChem CID 10266827) has the molecular formula C17H16OS2
and a molecular weight of 300.45 g/mol. Its IUPAC name is phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol.
Molecular Properties
| Compound Name | phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol |
| PubChem CID | 10266827 |
| Molecular Formula | C17H16OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol |
| SMILES | OC(C1=C(c2ccccc2)SCCS1)c1ccccc1 |
| InChI | InChI=1S/C17H16OS2/c18-15(13-7-3-1-4-8-13)17-16(19-11-12-20-17)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2 |
| InChIKey | DVAIUVKHHOYOSJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol?
The IUPAC name of phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol (CID 10266827) is phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol.
What is the SMILES notation for phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol?
The canonical SMILES for phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol is OC(C1=C(c2ccccc2)SCCS1)c1ccccc1.
What is the InChIKey of phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol?
The InChIKey is DVAIUVKHHOYOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16OS2/c18-15(13-7-3-1-4-8-13)17-16(19-11-12-20-17)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2.
What are the key properties of phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol?
phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol has a molecular weight of 300.45 g/mol, XLogP of 4.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(6-phenyl-2,3-dihydro-1,4-dithiin-5-yl)methanol is sourced from PubChem (CID 10266827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).