C16H16ClN3O — CID 102668638
4-[(4-amino-2,3-dihydroindol-1-yl)methyl]-3-chlorobenzamide (PubChem CID 102668638) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 4-[(4-amino-2,3-dihydroindol-1-yl)methyl]-3-chlorobenzamide.
| Compound Name | 4-[(4-amino-2,3-dihydroindol-1-yl)methyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 102668638 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-[(4-amino-2,3-dihydroindol-1-yl)methyl]-3-chlorobenzamide |
| SMILES | NC(=O)c1ccc(CN2CCc3c(N)cccc32)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClN3O/c17-13-8-10(16(19)21)4-5-11(13)9-20-7-6-12-14(18)2-1-3-15(12)20/h1-5,8H,6-7,9,18H2,(H2,19,21) |
| InChIKey | XFSWZFVTLPHXNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|