C20H31NO — CID 10266874
(2Z,4E,8E)-12-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,13-tetraenenitrile (PubChem CID 10266874) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (2Z,4E,8E)-12-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,13-tetraenenitrile.
| Compound Name | (2Z,4E,8E)-12-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,13-tetraenenitrile |
|---|---|
| PubChem CID | 10266874 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (2Z,4E,8E)-12-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,13-tetraenenitrile |
| SMILES | C=C(C)C(O)CC/C(C)=C/CC/C(C)=C/C=C(\C#N)C(C)C |
| InChI | InChI=1S/C20H31NO/c1-15(2)19(14-21)12-10-17(5)8-7-9-18(6)11-13-20(22)16(3)4/h9-10,12,15,20,22H,3,7-8,11,13H2,1-2,4-6H3/b17-10+,18-9+,19-12+ |
| InChIKey | TUGYCLWJUMRXMX-SRSFJCHESA-N |
| XLogP | 5.48 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|