C16H22N4O2 — CID 10266911
(11S)-10-(cyclopropylmethyl)-7-(hydroxymethylamino)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one (PubChem CID 10266911) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (11S)-10-(cyclopropylmethyl)-7-(hydroxymethylamino)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one.
| Compound Name | (11S)-10-(cyclopropylmethyl)-7-(hydroxymethylamino)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one |
|---|---|
| PubChem CID | 10266911 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (11S)-10-(cyclopropylmethyl)-7-(hydroxymethylamino)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-trien-2-one |
| SMILES | C[C@H]1Cn2c(=O)[nH]c3ccc(NCO)c(c32)CN1CC1CC1 |
| InChI | InChI=1S/C16H22N4O2/c1-10-6-20-15-12(8-19(10)7-11-2-3-11)13(17-9-21)4-5-14(15)18-16(20)22/h4-5,10-11,17,21H,2-3,6-9H2,1H3,(H,18,22)/t10-/m0/s1 |
| InChIKey | KOOXSGBUAUKKMN-JTQLQIEISA-N |
| XLogP | 1.31 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|